cas: 330794-02-0 — see every product listed under this CAS number, including other names
1-BROMO-2-FLUORO-5-METHOXY-4-NITROBENZENE, 97% (CAS 330794-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F332887-250MG |
| cas | 330794-02-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 122.89 Pln | |
| Fluorochem | 1g | 216.61 Pln | |
| Fluorochem | 5g | 627.92 Pln | |
| Fluorochem | 10g | 1096.51 Pln | |
| Fluorochem | 25g | 2184.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-2-fluoro-5-methoxy-4-nitrobenzene (CAS 330794-02-0) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-2-fluoro-5-methoxy-4-nitrobenzene. InChIKey: DBEXWIUEKLTMPE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-5-methoxy-4-nitrobenzene |
| InChIKey | DBEXWIUEKLTMPE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)