cas: 330794-02-0 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-5-methoxy-4-nitrobenzene, 97%, 97% (CAS 330794-02-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E48-100mg |
| cas | 330794-02-0 |
| size | 100mg |
| availability | 99.09g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2541.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-fluoro-5-methoxy-4-nitrobenzene (CAS 330794-02-0) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-2-fluoro-5-methoxy-4-nitrobenzene. InChIKey: DBEXWIUEKLTMPE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-5-methoxy-4-nitrobenzene |
| InChIKey | DBEXWIUEKLTMPE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1[N+](=O)[O-])F)Br |
Computed by PubChem (NCBI)