cas: 1015608-87-3 — see every product listed under this CAS number, including other names
1-Benzenesulfonyl-5-chloro-1H-pyrrolo[2,3-b]pyridine, 95+%, 95+% (CAS 1015608-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115SC-100mg |
| cas | 1015608-87-3 |
| size | 100mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 5g | 4130.00 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1240.40 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
1-(benzenesulfonyl)-5-chloropyrrolo[2,3-b]pyridine (CAS 1015608-87-3) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-chloropyrrolo[2,3-b]pyridine. InChIKey: BKKBVYRYQZHHTM-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-chloropyrrolo[2,3-b]pyridine |
| InChIKey | BKKBVYRYQZHHTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=CC(=CN=C32)Cl |
Computed by PubChem (NCBI)