CAS 744209-63-0 appears in our catalog under these names: 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 96%, 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine 98%, 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%, 98%, 4-Chloro-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 1g, 5g, 250mg, 50g.
1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine (CAS 744209-63-0) is a chemical compound with the molecular formula C13H9ClN2O2S and a molecular weight of 292.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine. InChIKey: ZWIKJILDMNXRAR-UHFFFAOYSA-N.
| Molecular formula | C13H9ClN2O2S |
|---|---|
| Molecular weight | 292.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloropyrrolo[2,3-b]pyridine |
| InChIKey | ZWIKJILDMNXRAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Cl |
Computed by PubChem (NCBI)