1-Benzyl-3,3-difluoropiperidine-4,4-diol, 95%
cas: 1067914-81-1 — see every product listed under this CAS number, including other names
1-Benzyl-3,3-difluoropiperidine-4,4-diol, 95% (CAS 1067914-81-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch119XPS-250mg |
| cas | 1067914-81-1 |
| size | 250mg |
| availability | 225g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 131.60 Pln | |
| Chemat | 5g | 386.00 Pln | |
| Chemat | 10g | 659.60 Pln | |
| Chemat | 25g | 1254.80 Pln | |
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 424.87 Pln | |
| Fluorochem | 10g | 789.32 Pln | |
| Fluorochem | 25g | 1476.58 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-3,3-difluoropiperidine-4,4-diol (CAS 1067914-81-1) is a chemical compound with the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. IUPAC name: 1-benzyl-3,3-difluoropiperidine-4,4-diol. InChIKey: VUYVXSSPDOWKFE-UHFFFAOYSA-N.
| Molecular formula | C12H15F2NO2 |
|---|---|
| Molecular weight | 243.25 g/mol |
| IUPAC name | 1-benzyl-3,3-difluoropiperidine-4,4-diol |
| InChIKey | VUYVXSSPDOWKFE-UHFFFAOYSA-N |
| SMILES | C1CN(CC(C1(O)O)(F)F)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)