cas: 214540-43-9 — see every product listed under this CAS number, including other names
1-Benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole, 97% (CAS 214540-43-9) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO07869CB |
| cas | 214540-43-9 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 260.14 Pln | |
| Thermo Scientific | 1g | 360.94 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
1-benzyl-3-bromo-5-fluoro-1,2,4-triazole (CAS 214540-43-9) is a chemical compound with the molecular formula C9H7BrFN3 and a molecular weight of 256.07 g/mol. IUPAC name: 1-benzyl-3-bromo-5-fluoro-1,2,4-triazole. InChIKey: MUYAKFNLCJMPDH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFN3 |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 1-benzyl-3-bromo-5-fluoro-1,2,4-triazole |
| InChIKey | MUYAKFNLCJMPDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC(=N2)Br)F |
Computed by PubChem (NCBI)