CAS 214540-43-9 appears in our catalog under these names: 1-Benzyl-3-bromo-5-fluoro-1h-1,2,4-triazole, 95%, 1-Benzyl-3-bromo-5-fluoro-1H-1,2,4-triazole, 97% . Offered by: Combi-blocks, Thermo Scientific. Available pack sizes: 1g, 5g, 250MG.
1-benzyl-3-bromo-5-fluoro-1,2,4-triazole (CAS 214540-43-9) is a chemical compound with the molecular formula C9H7BrFN3 and a molecular weight of 256.07 g/mol. IUPAC name: 1-benzyl-3-bromo-5-fluoro-1,2,4-triazole. InChIKey: MUYAKFNLCJMPDH-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFN3 |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 1-benzyl-3-bromo-5-fluoro-1,2,4-triazole |
| InChIKey | MUYAKFNLCJMPDH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC(=N2)Br)F |
Computed by PubChem (NCBI)