cas: 40114-49-6 — see every product listed under this CAS number, including other names
1-Benzyl-3-piperidone 95% (CAS 40114-49-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A721971-1g |
| cas | 40114-49-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 709.69 Pln | |
| Ambeed | 10g | 1026.75 Pln | |
| Ambeed | 25g | 1983.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A721971 |
1-benzylpiperidin-3-one (CAS 40114-49-6) is a chemical compound with the molecular formula C12H15NO and a molecular weight of 189.25 g/mol. IUPAC name: 1-benzylpiperidin-3-one. InChIKey: BBQQULRBTOMLTC-UHFFFAOYSA-N.
| Molecular formula | C12H15NO |
|---|---|
| Molecular weight | 189.25 g/mol |
| IUPAC name | 1-benzylpiperidin-3-one |
| InChIKey | BBQQULRBTOMLTC-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CN(C1)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)