cas: 150435-81-7 — see every product listed under this CAS number, including other names
1-Benzyl-4-((tert-butoxycarbonyl)amino)piperidine-4-carboxylic acid 97% (CAS 150435-81-7) is a chemical reagent available from Chemat. Available pack sizes: 25g, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A208152-25g |
| cas | 150435-81-7 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 3096.00 Pln | |
| Ambeed | 1g | 364.81 Pln | |
| Ambeed | 5g | 909.94 Pln | |
| Ambeed | 10g | 1583.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A208152 |
1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylic acid (CAS 150435-81-7) is a chemical compound with the molecular formula C18H26N2O4 and a molecular weight of 334.4 g/mol. IUPAC name: 1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylic acid. InChIKey: WZXFCLVBUXTWRS-UHFFFAOYSA-N.
| Molecular formula | C18H26N2O4 |
|---|---|
| Molecular weight | 334.4 g/mol |
| IUPAC name | 1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylic acid |
| InChIKey | WZXFCLVBUXTWRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCN(CC1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)