cas: 1015242-03-1 — see every product listed under this CAS number, including other names
1-Benzyl-4-(5-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-yl)Pyridin-2-yl)Piperazine, 98%, 98% (CAS 1015242-03-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1115PG-100mg |
| cas | 1015242-03-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 1g | 899.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine (CAS 1015242-03-1) is a chemical compound with the molecular formula C22H30BN3O2 and a molecular weight of 379.3 g/mol. IUPAC name: 1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine. InChIKey: AFNSMUFYAVDYMJ-UHFFFAOYSA-N.
| Molecular formula | C22H30BN3O2 |
|---|---|
| Molecular weight | 379.3 g/mol |
| IUPAC name | 1-benzyl-4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]piperazine |
| InChIKey | AFNSMUFYAVDYMJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)N3CCN(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)