cas: 1352926-13-6 — see every product listed under this CAS number, including other names
1-Benzyl-4-bromo-3-methyl-1H-pyrazole-5-carboxamide, 95%, 95% (CAS 1352926-13-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ZMW-100mg |
| cas | 1352926-13-6 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 789.20 Pln | |
| Chemat | 250mg | 1221.20 Pln | |
| Chemat | 1g | 3069.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-4-bromo-3-methylpyrazole-5-carboxamide (CAS 1352926-13-6) is a chemical compound with the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. IUPAC name: 1-benzyl-4-bromo-3-methylpyrazole-5-carboxamide. InChIKey: SWGUCROCDBPHGE-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN3O |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | 1-benzyl-4-bromo-3-methylpyrazole-5-carboxamide |
| InChIKey | SWGUCROCDBPHGE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1Br)C(=O)N)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)