CAS 2581778-94-9 is the registry number for (E)-1-(8-Bromoimidazo[1,2-a]pyridin-3-yl)-3-(dimethylamino)prop-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-1-(8-bromoimidazo[1,2-a]pyridin-3-yl)-3-(dimethylamino)prop-2-en-1-one (CAS 2581778-94-9) is a chemical compound with the molecular formula C12H12BrN3O and a molecular weight of 294.15 g/mol. IUPAC name: (E)-1-(8-bromoimidazo[1,2-a]pyridin-3-yl)-3-(dimethylamino)prop-2-en-1-one. InChIKey: IHADWGRILWLROI-FNORWQNLSA-N.
| Molecular formula | C12H12BrN3O |
|---|---|
| Molecular weight | 294.15 g/mol |
| IUPAC name | (E)-1-(8-bromoimidazo[1,2-a]pyridin-3-yl)-3-(dimethylamino)prop-2-en-1-one |
| InChIKey | IHADWGRILWLROI-FNORWQNLSA-N |
| SMILES | CN(C)/C=C/C(=O)C1=CN=C2N1C=CC=C2Br |
Computed by PubChem (NCBI)