cas: 63843-83-4 — see every product listed under this CAS number, including other names
1-Benzyl-4-phenylpiperidin-4-ol, 95%, 95% (CAS 63843-83-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E0RK-250mg |
| cas | 63843-83-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 664.40 Pln | |
| Chemat | 5g | 2032.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-benzyl-4-phenylpiperidin-4-ol (CAS 63843-83-4) is a chemical compound with the molecular formula C18H21NO and a molecular weight of 267.4 g/mol. IUPAC name: 1-benzyl-4-phenylpiperidin-4-ol. InChIKey: FCLMXEAPEVBCKQ-UHFFFAOYSA-N.
| Molecular formula | C18H21NO |
|---|---|
| Molecular weight | 267.4 g/mol |
| IUPAC name | 1-benzyl-4-phenylpiperidin-4-ol |
| InChIKey | FCLMXEAPEVBCKQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1(C2=CC=CC=C2)O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)