cas: 949-69-9 — see every product listed under this CAS number, including other names
1-Benzyl-piperidin-4-one oxime, 96% (CAS 949-69-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036906-25G |
| cas | 949-69-9 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 351.98 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
N-(1-benzylpiperidin-4-ylidene)hydroxylamine (CAS 949-69-9) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: N-(1-benzylpiperidin-4-ylidene)hydroxylamine. InChIKey: VIMRHNNRKUWOIZ-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | N-(1-benzylpiperidin-4-ylidene)hydroxylamine |
| InChIKey | VIMRHNNRKUWOIZ-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=NO)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)