CAS 144583-88-0 is the registry number for 6-Amino-1,4,4-trimethyl-3,4-dihydroquinolin-2(1h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
6-amino-1,4,4-trimethyl-3H-quinolin-2-one (CAS 144583-88-0) is a chemical compound with the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. IUPAC name: 6-amino-1,4,4-trimethyl-3H-quinolin-2-one. InChIKey: SXZYEXBLVNQJHA-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | 6-amino-1,4,4-trimethyl-3H-quinolin-2-one |
| InChIKey | SXZYEXBLVNQJHA-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)N(C2=C1C=C(C=C2)N)C)C |
Computed by PubChem (NCBI)