cas: 1208-76-0 — see every product listed under this CAS number, including other names
1-Benzylazepan-4-one hydrochloride, 97% (CAS 1208-76-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A985027-5g |
| cas | 1208-76-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8363.74 Pln | |
| AmBeed | 10g | 12425.98 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-benzylazepan-4-one;hydrochloride (CAS 1208-76-0) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 1-benzylazepan-4-one;hydrochloride. InChIKey: TVIICJDDSIMWQT-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 1-benzylazepan-4-one;hydrochloride |
| InChIKey | TVIICJDDSIMWQT-UHFFFAOYSA-N |
| SMILES | C1CC(=O)CCN(C1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)