CAS 1992956-36-1 appears in our catalog under these names: 6-Methyl-2h-spiro[1-benzofuran-3,4'-piperidine] hydrochloride, 95%, 6-Methyl-2H-spiro(benzofuran-3,4'-piperidine) hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
6-methylspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride (CAS 1992956-36-1) is a chemical compound with the molecular formula C13H18ClNO and a molecular weight of 239.74 g/mol. IUPAC name: 6-methylspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: QRBMCBGGKBEGEJ-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | 6-methylspiro[2H-1-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | QRBMCBGGKBEGEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3(CCNCC3)CO2.Cl |
Computed by PubChem (NCBI)