1-Benzylpiperidin-3-amine hydrochloride, 95%
cas: 368429-78-1 — see every product listed under this CAS number, including other names
1-Benzylpiperidin-3-amine hydrochloride, 95% (CAS 368429-78-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A200174-250mg |
| cas | 368429-78-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 492.75 Pln | |
| Ambeed | 25g | 1633.06 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Fluorochem | 250mg | 211.40 Pln | |
| Fluorochem | 1g | 341.56 Pln | |
| Fluorochem | 5g | 872.63 Pln | |
| BLDpharm | 250mg | 158.86 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 525.40 Pln | |
| BLDpharm | 25g | 1752.74 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-benzylpiperidin-3-amine;hydrochloride (CAS 368429-78-1) is a chemical compound with the molecular formula C12H19ClN2 and a molecular weight of 226.74 g/mol. IUPAC name: 1-benzylpiperidin-3-amine;hydrochloride. InChIKey: NLKWAJAEIWXJJY-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2 |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 1-benzylpiperidin-3-amine;hydrochloride |
| InChIKey | NLKWAJAEIWXJJY-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)