Products 1185718-80-2

CAS 1185718-80-2 is the registry number for N-Methyl-1-(1-phenyl-3-pyrrolidinyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

N-methyl-1-(1-phenylpyrrolidin-3-yl)methanamine;hydrochloride (CAS 1185718-80-2) is a chemical compound with the molecular formula C12H19ClN2 and a molecular weight of 226.74 g/mol. IUPAC name: N-methyl-1-(1-phenylpyrrolidin-3-yl)methanamine;hydrochloride. InChIKey: PWAKPFUBGLPXLX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19ClN2
Molecular weight226.74 g/mol
IUPAC nameN-methyl-1-(1-phenylpyrrolidin-3-yl)methanamine;hydrochloride
InChIKeyPWAKPFUBGLPXLX-UHFFFAOYSA-N
SMILESCNCC1CCN(C1)C2=CC=CC=C2.Cl

Computed by PubChem (NCBI)