cas: 21319-53-9 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-2-carboxylic acid, 97% (CAS 21319-53-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078173-5G |
| cas | 21319-53-9 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 200.99 Pln | |
| Fluorochem | 10g | 310.33 Pln | |
| Fluorochem | 25g | 653.95 Pln | |
| Fluorochem | 100g | 1799.38 Pln | |
| Fluorochem | 500g | 8796.92 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-benzylpiperidine-2-carboxylic acid (CAS 21319-53-9) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-benzylpiperidine-2-carboxylic acid. InChIKey: FEUCBQVXYVZGCM-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-benzylpiperidine-2-carboxylic acid |
| InChIKey | FEUCBQVXYVZGCM-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)