Products 21319-53-9
CAS 21319-53-9 appears in our catalog under these names: 1-Benzylpiperidine-2-carboxylic acid, 95%, 1-Benzylpiperidine-2-carboxylic acid 97%, 1-Benzylpiperidine-2-Carboxylic Acid, 97%, 97%, 1-Benzylpiperidine-2-carboxylic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 100g, 500g.
1-benzylpiperidine-2-carboxylic acid (CAS 21319-53-9) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-benzylpiperidine-2-carboxylic acid. InChIKey: FEUCBQVXYVZGCM-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-benzylpiperidine-2-carboxylic acid |
| InChIKey | FEUCBQVXYVZGCM-UHFFFAOYSA-N |
| SMILES | C1CCN(C(C1)C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)