1-Benzylpiperidine-3-carbohydrazide, 95+%
cas: 182919-58-0 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-3-carbohydrazide, 95+% (CAS 182919-58-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A556886-250mg |
| cas | 182919-58-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 743.06 Pln | |
| Ambeed | 1g | 1861.13 Pln | |
| Chemat | 100mg | 443.60 Pln | |
| Chemat | 250mg | 707.60 Pln | |
| Chemat | 1g | 1797.20 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 791.97 Pln | |
| BLDpharm | 1g | 2002.65 Pln | |
| Fluorochem | 100mg | 804.94 Pln | |
| Fluorochem | 250mg | 1304.77 Pln | |
| Fluorochem | 1g | 3319.68 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
1-benzylpiperidine-3-carbohydrazide (CAS 182919-58-0) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: 1-benzylpiperidine-3-carbohydrazide. InChIKey: WUDDEGZXFZWRKR-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carbohydrazide |
| InChIKey | WUDDEGZXFZWRKR-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)NN |
Computed by PubChem (NCBI)