CAS 1180131-77-4 appears in our catalog under these names: 3-Methyl-4-(4-methylpiperazine-1-carbonyl)aniline, 97%, 3-Methyl-4-(4-methylpiperazine-1-carbonyl)aniline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(4-amino-2-methylphenyl)-(4-methylpiperazin-1-yl)methanone (CAS 1180131-77-4) is a chemical compound with the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. IUPAC name: (4-amino-2-methylphenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: GFXVYVATZQBZRA-UHFFFAOYSA-N.
| Molecular formula | C13H19N3O |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | (4-amino-2-methylphenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | GFXVYVATZQBZRA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)C(=O)N2CCN(CC2)C |
Computed by PubChem (NCBI)