cas: 141943-04-6 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-3-carboxylic acid, 97%, 97% (CAS 141943-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112HFQ-250mg |
| cas | 141943-04-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 10g | 2123.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-benzylpiperidine-3-carboxylic acid (CAS 141943-04-6) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-benzylpiperidine-3-carboxylic acid. InChIKey: HGCSHWVOIUCAJN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carboxylic acid |
| InChIKey | HGCSHWVOIUCAJN-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)