cas: 141943-04-6 — see every product listed under this CAS number, including other names
1-Benzylpiperidine-3-carboxylic acid, 97% (CAS 141943-04-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g, 1g, 250mg, 2.5g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-5494-10g |
| cas | 141943-04-6 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 2.5g | 591.48 Pln | |
| Fluorochem | 5g | 1096.51 Pln | |
| Fluorochem | 10g | 2137.81 Pln | |
| Fluorochem | 25g | 4475.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-benzylpiperidine-3-carboxylic acid (CAS 141943-04-6) is a chemical compound with the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. IUPAC name: 1-benzylpiperidine-3-carboxylic acid. InChIKey: HGCSHWVOIUCAJN-UHFFFAOYSA-N.
| Molecular formula | C13H17NO2 |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 1-benzylpiperidine-3-carboxylic acid |
| InChIKey | HGCSHWVOIUCAJN-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)CC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)