cas: 960294-18-2 — see every product listed under this CAS number, including other names
1-Boc-1,8-Diazaspiro[5.5]Undecane, 95%, 95% (CAS 960294-18-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E1R-100mg |
| cas | 960294-18-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 390.80 Pln | |
| Chemat | 1g | 962.00 Pln | |
| Chemat | 5g | 2762.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate (CAS 960294-18-2) is a chemical compound with the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate. InChIKey: VPLODDZAJNYXTC-UHFFFAOYSA-N.
| Molecular formula | C14H26N2O2 |
|---|---|
| Molecular weight | 254.37 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[5.5]undecane-1-carboxylate |
| InChIKey | VPLODDZAJNYXTC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC12CCCNC2 |
Computed by PubChem (NCBI)