cas: 69610-40-8 — see every product listed under this CAS number, including other names
1-Boc-2-(S)-pyrrolidinemethanol 98% (CAS 69610-40-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A137477-25g |
| cas | 69610-40-8 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 275.81 Pln | |
| Ambeed | 500g | 876.56 Pln | |
| Ambeed | 1000g | 1443.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A137477 |
Tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 69610-40-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BFFLLBPMZCIGRM-QMMMGPOBSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BFFLLBPMZCIGRM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO |
Computed by PubChem (NCBI)