cas: 69610-40-8 — see every product listed under this CAS number, including other names
Boc-L-Prolinol (CAS 69610-40-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | BAL1010.0005 |
| cas | 69610-40-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 5g | 611.60 Pln | |
| Iris Biotech | 25g | 912.56 Pln | |
| Iris Biotech | 100g | 1664.96 Pln | |
| Iris Biotech | 250g | 3320.24 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
Tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 69610-40-8) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BFFLLBPMZCIGRM-QMMMGPOBSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2S)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BFFLLBPMZCIGRM-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1CO |
Computed by PubChem (NCBI)