cas: 481038-63-5 — see every product listed under this CAS number, including other names
1-Boc-2-Benzylpiperazine, 95% (CAS 481038-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F223226-100MG |
| cas | 481038-63-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 575.86 Pln | |
| Fluorochem | 1g | 1283.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 2-benzylpiperazine-1-carboxylate (CAS 481038-63-5) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl 2-benzylpiperazine-1-carboxylate. InChIKey: QKUHUJCLUFLGCI-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl 2-benzylpiperazine-1-carboxylate |
| InChIKey | QKUHUJCLUFLGCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)