cas: 481038-63-5 — see every product listed under this CAS number, including other names
1-Boc-2-Benzylpiperazine, 96%, 96% (CAS 481038-63-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117Y16-100mg |
| cas | 481038-63-5 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 726.80 Pln | |
| Chemat | 5g | 2387.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2-benzylpiperazine-1-carboxylate (CAS 481038-63-5) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 276.37 g/mol. IUPAC name: tert-butyl 2-benzylpiperazine-1-carboxylate. InChIKey: QKUHUJCLUFLGCI-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 276.37 g/mol |
| IUPAC name | tert-butyl 2-benzylpiperazine-1-carboxylate |
| InChIKey | QKUHUJCLUFLGCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)