cas: 362704-66-3 — see every product listed under this CAS number, including other names
1-Boc-2-methyl-piperidin-5-one, 97% (CAS 362704-66-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330251-250MG |
| cas | 362704-66-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 500mg | 1158.98 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 8026.36 Pln | |
| Fluorochem | 10g | 15117.61 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate (CAS 362704-66-3) is a chemical compound with the molecular formula C11H19NO3 and a molecular weight of 213.27 g/mol. IUPAC name: tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate. InChIKey: CSTUUOYWLVVNLE-UHFFFAOYSA-N.
| Molecular formula | C11H19NO3 |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | tert-butyl 2-methyl-5-oxopiperidine-1-carboxylate |
| InChIKey | CSTUUOYWLVVNLE-UHFFFAOYSA-N |
| SMILES | CC1CCC(=O)CN1C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)