cas: 305329-97-9 — see every product listed under this CAS number, including other names
1-Boc-3-(bromomethyl)pyrrolidine 97% (CAS 305329-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A117494-100mg |
| cas | 305329-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 982.25 Pln | |
| Ambeed | 25g | 3702.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A117494 |
Tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate (CAS 305329-97-9) is a chemical compound with the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. IUPAC name: tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate. InChIKey: NQNGQGISAMHLST-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO2 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate |
| InChIKey | NQNGQGISAMHLST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CBr |
Computed by PubChem (NCBI)