cas: 305329-97-9 — see every product listed under this CAS number, including other names
3-Bromomethyl-pyrrolidine-1-carboxylic acid tert-butyl ester, 95% (CAS 305329-97-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F088275-250MG |
| cas | 305329-97-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 581.06 Pln | |
| Fluorochem | 10g | 1106.92 Pln | |
| Fluorochem | 25g | 2689.70 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate (CAS 305329-97-9) is a chemical compound with the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. IUPAC name: tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate. InChIKey: NQNGQGISAMHLST-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO2 |
|---|---|
| Molecular weight | 264.16 g/mol |
| IUPAC name | tert-butyl 3-(bromomethyl)pyrrolidine-1-carboxylate |
| InChIKey | NQNGQGISAMHLST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)CBr |
Computed by PubChem (NCBI)