cas: 775305-12-9 — see every product listed under this CAS number, including other names
1-Boc-3-Bromo-2-methylindole 95% (CAS 775305-12-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A105875-250mg |
| cas | 775305-12-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 153.44 Pln | |
| Ambeed | 5g | 359.25 Pln | |
| Ambeed | 25g | 1037.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A105875 |
Tert-butyl 3-bromo-2-methylindole-1-carboxylate (CAS 775305-12-9) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 3-bromo-2-methylindole-1-carboxylate. InChIKey: RUAYZSFSPSZYHI-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-methylindole-1-carboxylate |
| InChIKey | RUAYZSFSPSZYHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)