cas: 122684-34-8 — see every product listed under this CAS number, including other names
1-Boc-3-Carbamoylpyrrolidine 97% (CAS 122684-34-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A226480-250mg |
| cas | 122684-34-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 209.06 Pln | |
| Ambeed | 5g | 720.81 Pln | |
| Ambeed | 25g | 2345.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A226480 |
Tert-butyl 3-carbamoylpyrrolidine-1-carboxylate (CAS 122684-34-8) is a chemical compound with the molecular formula C10H18N2O3 and a molecular weight of 214.26 g/mol. IUPAC name: tert-butyl 3-carbamoylpyrrolidine-1-carboxylate. InChIKey: NHDGOVOBEZPXMY-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O3 |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | tert-butyl 3-carbamoylpyrrolidine-1-carboxylate |
| InChIKey | NHDGOVOBEZPXMY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(=O)N |
Computed by PubChem (NCBI)