cas: 1262411-27-7 — see every product listed under this CAS number, including other names
1-Boc-3-amino-3-(hydroxymethyl)azetidine, 95% (CAS 1262411-27-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 50mg, 100mg, 500mg, 10g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QM-7497-1g |
| cas | 1262411-27-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 50mg | 310.33 Pln | |
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 659.16 Pln | |
| Fluorochem | 500mg | 1138.16 Pln | |
| Fluorochem | 1g | 1716.08 Pln | |
| Fluorochem | 5g | 5980.20 Pln | |
| Fluorochem | 10g | 9744.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate (CAS 1262411-27-7) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate. InChIKey: JWVHLOXEHDYSLW-UHFFFAOYSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(hydroxymethyl)azetidine-1-carboxylate |
| InChIKey | JWVHLOXEHDYSLW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CO)N |
Computed by PubChem (NCBI)