cas: 301673-16-5 — see every product listed under this CAS number, including other names
1-Boc-3-hydroxymethylpiperazine, 97%, 97% (CAS 301673-16-5) is a chemical reagent available from Chemat. Available pack sizes: 250g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1149TX-250g |
| cas | 301673-16-5 |
| size | 250g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250g | 1922.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 122.00 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 856.40 Pln | |
| Chemat | 500g | 3076.80 Pln | |
| Chemat | 1kg | 4605.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate (CAS 301673-16-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)CO |
Computed by PubChem (NCBI)