cas: 301673-16-5 — see every product listed under this CAS number, including other names
tert-Butyl 3-(hydroxymethyl)piperazine-1-carboxylate 97% (CAS 301673-16-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A234519-250mg |
| cas | 301673-16-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 236.88 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 414.88 Pln | |
| Ambeed | 100g | 1327.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A234519 |
Tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate (CAS 301673-16-5) is a chemical compound with the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate. InChIKey: NSILYQWHARROMG-UHFFFAOYSA-N.
| Molecular formula | C10H20N2O3 |
|---|---|
| Molecular weight | 216.28 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)piperazine-1-carboxylate |
| InChIKey | NSILYQWHARROMG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNC(C1)CO |
Computed by PubChem (NCBI)