cas: 444892-54-0 — see every product listed under this CAS number, including other names
1-Boc-4-(2-Amino-1-phenylethyl)piperazine, 97% (CAS 444892-54-0) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228016-500MG |
| cas | 444892-54-0 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1497.41 Pln | |
| Fluorochem | 1g | 2294.00 Pln | |
| Fluorochem | 5g | 7182.91 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(2-amino-1-phenylethyl)piperazine-1-carboxylate (CAS 444892-54-0) is a chemical compound with the molecular formula C17H27N3O2 and a molecular weight of 305.4 g/mol. IUPAC name: tert-butyl 4-(2-amino-1-phenylethyl)piperazine-1-carboxylate. InChIKey: NOVUBWBKZLPMFG-UHFFFAOYSA-N.
| Molecular formula | C17H27N3O2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | tert-butyl 4-(2-amino-1-phenylethyl)piperazine-1-carboxylate |
| InChIKey | NOVUBWBKZLPMFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C(CN)C2=CC=CC=C2 |
Computed by PubChem (NCBI)