Products 1189106-71-5

CAS 1189106-71-5 is the registry number for 4-(4-Amino-benzylamino)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(4-aminophenyl)methylamino]piperidine-1-carboxylate (CAS 1189106-71-5) is a chemical compound with the molecular formula C17H27N3O2 and a molecular weight of 305.4 g/mol. IUPAC name: tert-butyl 4-[(4-aminophenyl)methylamino]piperidine-1-carboxylate. InChIKey: HBKSHEPHTFBUGC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H27N3O2
Molecular weight305.4 g/mol
IUPAC nametert-butyl 4-[(4-aminophenyl)methylamino]piperidine-1-carboxylate
InChIKeyHBKSHEPHTFBUGC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)NCC2=CC=C(C=C2)N

Computed by PubChem (NCBI)