cas: 149377-19-5 — see every product listed under this CAS number, including other names
1-Boc-4-Hydroxyphenylpiperidine, 97% (CAS 149377-19-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F046163-250MG |
| cas | 149377-19-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 419.66 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 2637.63 Pln | |
| Fluorochem | 10g | 4767.09 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(4-hydroxyphenyl)piperidine-1-carboxylate (CAS 149377-19-5) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl 4-(4-hydroxyphenyl)piperidine-1-carboxylate. InChIKey: CUUQNEXFGPWNPJ-UHFFFAOYSA-N.
| Molecular formula | C16H23NO3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl 4-(4-hydroxyphenyl)piperidine-1-carboxylate |
| InChIKey | CUUQNEXFGPWNPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)