CAS 799559-75-4 appears in our catalog under these names: Erythro-n-boc-l-homophenylalanine epoxide, 95%, (S)-(2S,3R)-3,4-Dihydroxybutan-2-yl 2-((tert-butoxycarbonyl)amino)-4-phenylbutanoate, 98+%, Erythro-N-Boc-L-homophenylalanine epoxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 25mg, 500mg.
Tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-3-phenylpropyl]carbamate (CAS 799559-75-4) is a chemical compound with the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-3-phenylpropyl]carbamate. InChIKey: QBDJHEUSBYIOGK-UONOGXRCSA-N.
| Molecular formula | C16H23NO3 |
|---|---|
| Molecular weight | 277.36 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[(2S)-oxiran-2-yl]-3-phenylpropyl]carbamate |
| InChIKey | QBDJHEUSBYIOGK-UONOGXRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC1=CC=CC=C1)[C@H]2CO2 |
Computed by PubChem (NCBI)