cas: 158407-04-6 — see every product listed under this CAS number, including other names
1-Boc-4-bromomethylpiperidine, 97%, 97% (CAS 158407-04-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Q73-250mg |
| cas | 158407-04-6 |
| size | 250mg |
| availability | 5000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 64.40 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 155.60 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 458.00 Pln | |
| Chemat | 100g | 818.00 Pln | |
| Chemat | 250g | 1907.60 Pln | |
| Chemat | 1kg | 2459.60 Pln | |
| Chemat | 5kg | 11760.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(bromomethyl)piperidine-1-carboxylate (CAS 158407-04-6) is a chemical compound with the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. IUPAC name: tert-butyl 4-(bromomethyl)piperidine-1-carboxylate. InChIKey: YGJXBTRLYHCWGD-UHFFFAOYSA-N.
| Molecular formula | C11H20BrNO2 |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | tert-butyl 4-(bromomethyl)piperidine-1-carboxylate |
| InChIKey | YGJXBTRLYHCWGD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CBr |
Computed by PubChem (NCBI)