CAS 2086689-85-0 appears in our catalog under these names: 1-[2-(tert-Butoxy)-2-oxoethyl]-5-methyl-3,4-dihydro-2h-pyrrolium bromide, 95%, 1-[2-(tert-Butoxy)-2-oxoethyl]-5-methyl-3,4-dihydro-2H-pyrrolium Bromide, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g.
Tert-butyl 2-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)acetate bromide (CAS 2086689-85-0) is a chemical compound with the molecular formula C11H20BrNO2 and a molecular weight of 278.19 g/mol. IUPAC name: tert-butyl 2-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)acetate bromide. InChIKey: NJGCPPGNSKBYKT-UHFFFAOYSA-M.
| Molecular formula | C11H20BrNO2 |
|---|---|
| Molecular weight | 278.19 g/mol |
| IUPAC name | tert-butyl 2-(5-methyl-3,4-dihydro-2H-pyrrol-1-ium-1-yl)acetate bromide |
| InChIKey | NJGCPPGNSKBYKT-UHFFFAOYSA-M |
| SMILES | CC1=[N+](CCC1)CC(=O)OC(C)(C)C.[Br-] |
Computed by PubChem (NCBI)