cas: 1211595-59-3 — see every product listed under this CAS number, including other names
1-Boc-6-Methyl-1,4-diazepane, 97% (CAS 1211595-59-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A559838-10g |
| cas | 1211595-59-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10297.21 Pln | |
| Fluorochem | 100mg | 1091.30 Pln | |
| Fluorochem | 250mg | 1434.93 Pln | |
| Fluorochem | 500mg | 2325.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 6-methyl-1,4-diazepane-1-carboxylate (CAS 1211595-59-3) is a chemical compound with the molecular formula C11H22N2O2 and a molecular weight of 214.30 g/mol. IUPAC name: tert-butyl 6-methyl-1,4-diazepane-1-carboxylate. InChIKey: KPOYZVQMOOKKQV-UHFFFAOYSA-N.
| Molecular formula | C11H22N2O2 |
|---|---|
| Molecular weight | 214.30 g/mol |
| IUPAC name | tert-butyl 6-methyl-1,4-diazepane-1-carboxylate |
| InChIKey | KPOYZVQMOOKKQV-UHFFFAOYSA-N |
| SMILES | CC1CNCCN(C1)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)