cas: 885272-44-6 — see every product listed under this CAS number, including other names
1-Boc-7-aminoindoline, 97% (CAS 885272-44-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A800064-10g |
| cas | 885272-44-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6443.29 Pln | |
| AmBeed | 250mg | 538.72 Pln | |
| AmBeed | 5g | 3878.35 Pln | |
| AmBeed | 100mg | 408.52 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate (CAS 885272-44-6) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate. InChIKey: IGGCXTTVKSYIIK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate |
| InChIKey | IGGCXTTVKSYIIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C(=CC=C2)N |
Computed by PubChem (NCBI)