cas: 885272-44-6 — see every product listed under this CAS number, including other names
tert-Butyl 7-aminoindoline-1-carboxylate, 97% (CAS 885272-44-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F239450-100MG |
| cas | 885272-44-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 393.63 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 500mg | 794.53 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3413.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate (CAS 885272-44-6) is a chemical compound with the molecular formula C13H18N2O2 and a molecular weight of 234.29 g/mol. IUPAC name: tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate. InChIKey: IGGCXTTVKSYIIK-UHFFFAOYSA-N.
| Molecular formula | C13H18N2O2 |
|---|---|
| Molecular weight | 234.29 g/mol |
| IUPAC name | tert-butyl 7-amino-2,3-dihydroindole-1-carboxylate |
| InChIKey | IGGCXTTVKSYIIK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C(=CC=C2)N |
Computed by PubChem (NCBI)