cas: 2304635-53-6 — see every product listed under this CAS number, including other names
1-Boc-azetidine-3-boronic Acid Pinacol Ester, 97% (CAS 2304635-53-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL5R-100mg |
| cas | 2304635-53-6 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 500mg | 304.40 Pln | |
| Chemat | 1g | 371.60 Pln | |
| Chemat | 5g | 1067.60 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2958.80 Pln | |
| Chemat | 50g | 5022.80 Pln | |
| Chemat | 500g | 22276.80 Pln | |
| Chemat | 1kg | 35618.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate (CAS 2304635-53-6) is a chemical compound with the molecular formula C14H26BNO4 and a molecular weight of 283.17 g/mol. IUPAC name: tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate. InChIKey: OGIREDKIFYTFOQ-UHFFFAOYSA-N.
| Molecular formula | C14H26BNO4 |
|---|---|
| Molecular weight | 283.17 g/mol |
| IUPAC name | tert-butyl 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)azetidine-1-carboxylate |
| InChIKey | OGIREDKIFYTFOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)