cas: 5153-40-2 — see every product listed under this CAS number, including other names
1-Bromo-2,3,4,5,6-pentamethylbenzene, 98%, 98% (CAS 5153-40-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114OKR-1g |
| cas | 5153-40-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 203.60 Pln | |
| Chemat | 100g | 549.20 Pln | |
| Chemat | 500g | 2044.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2,3,4,5,6-pentamethylbenzene (CAS 5153-40-2) is a chemical compound with the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. IUPAC name: 1-bromo-2,3,4,5,6-pentamethylbenzene. InChIKey: XPDQRULPGCFCLX-UHFFFAOYSA-N.
| Molecular formula | C11H15Br |
|---|---|
| Molecular weight | 227.14 g/mol |
| IUPAC name | 1-bromo-2,3,4,5,6-pentamethylbenzene |
| InChIKey | XPDQRULPGCFCLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)Br)C)C |
Computed by PubChem (NCBI)