cas: 5153-40-2 — see every product listed under this CAS number, including other names
Bromopentamethylbenzene, >97.0%(GC) (CAS 5153-40-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B4154-5G |
| cas | 5153-40-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 201.94 Pln | |
| TCI | 25g | 919.86 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
1-bromo-2,3,4,5,6-pentamethylbenzene (CAS 5153-40-2) is a chemical compound with the molecular formula C11H15Br and a molecular weight of 227.14 g/mol. IUPAC name: 1-bromo-2,3,4,5,6-pentamethylbenzene. InChIKey: XPDQRULPGCFCLX-UHFFFAOYSA-N.
| Molecular formula | C11H15Br |
|---|---|
| Molecular weight | 227.14 g/mol |
| IUPAC name | 1-bromo-2,3,4,5,6-pentamethylbenzene |
| InChIKey | XPDQRULPGCFCLX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1C)C)Br)C)C |
Computed by PubChem (NCBI)